C13H23NO — CID 62998644
N-(furan-3-ylmethyl)-2,4,4-trimethylpentan-2-amine (PubChem CID 62998644) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-(furan-3-ylmethyl)-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 62998644 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCc1ccoc1 |
| InChI | InChI=1S/C13H23NO/c1-12(2,3)10-13(4,5)14-8-11-6-7-15-9-11/h6-7,9,14H,8,10H2,1-5H3 |
| InChIKey | MUOUGXRPIFQPKT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |