C15H24FN — CID 43434198
N-[(3-fluorophenyl)methyl]-2,4,4-trimethylpentan-2-amine (PubChem CID 43434198) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 43434198 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCc1cccc(F)c1 |
| InChI | InChI=1S/C15H24FN/c1-14(2,3)11-15(4,5)17-10-12-7-6-8-13(16)9-12/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | CBHINUMMUBXALL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |