C16H24FNO — CID 78800383
2-(3-fluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)acetamide (PubChem CID 78800383) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 78800383 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)acetamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H24FNO/c1-15(2,3)11-16(4,5)18-14(19)10-12-7-6-8-13(17)9-12/h6-9H,10-11H2,1-5H3,(H,18,19) |
| InChIKey | QFBMBUQLYHPOSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |