C12H17FN2OS — CID 143768641
ethane;2-(3-fluorophenyl)-N-(methylcarbamothioyl)acetamide (PubChem CID 143768641) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is ethane;2-(3-fluorophenyl)-N-(methylcarbamothioyl)acetamide.
| Compound Name | ethane;2-(3-fluorophenyl)-N-(methylcarbamothioyl)acetamide |
|---|---|
| PubChem CID | 143768641 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | ethane;2-(3-fluorophenyl)-N-(methylcarbamothioyl)acetamide |
| SMILES | CC.CNC(=S)NC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C10H11FN2OS.C2H6/c1-12-10(15)13-9(14)6-7-3-2-4-8(11)5-7;1-2/h2-5H,6H2,1H3,(H2,12,13,14,15);1-2H3 |
| InChIKey | DXVBMVBJRBKBFY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|