C17H20FNO — CID 62998866
N-[2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)propyl]cyclopropanamine (PubChem CID 62998866) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is N-[2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)propyl]cyclopropanamine.
| Compound Name | N-[2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62998866 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)propyl]cyclopropanamine |
| SMILES | Fc1cccc(CC(CNC2CC2)Cc2ccco2)c1 |
| InChI | InChI=1S/C17H20FNO/c18-15-4-1-3-13(10-15)9-14(12-19-16-6-7-16)11-17-5-2-8-20-17/h1-5,8,10,14,16,19H,6-7,9,11-12H2 |
| InChIKey | GAMBULVYDWZVAZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |