C17H22FNO — CID 62998676
2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)-N-propylpropan-1-amine (PubChem CID 62998676) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)-N-propylpropan-1-amine.
| Compound Name | 2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62998676 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-3-(furan-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1cccc(F)c1)Cc1ccco1 |
| InChI | InChI=1S/C17H22FNO/c1-2-8-19-13-15(12-17-7-4-9-20-17)10-14-5-3-6-16(18)11-14/h3-7,9,11,15,19H,2,8,10,12-13H2,1H3 |
| InChIKey | WOXJHSAFUJXPNH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|