C17H21BrFNS — CID 63521377
2-[(3-bromothiophen-2-yl)methyl]-3-(3-fluorophenyl)-N-propylpropan-1-amine (PubChem CID 63521377) has the molecular formula C17H21BrFNS and a molecular weight of 370.33 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methyl]-3-(3-fluorophenyl)-N-propylpropan-1-amine.
| Compound Name | 2-[(3-bromothiophen-2-yl)methyl]-3-(3-fluorophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 63521377 |
| Molecular Formula | C17H21BrFNS |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methyl]-3-(3-fluorophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1cccc(F)c1)Cc1sccc1Br |
| InChI | InChI=1S/C17H21BrFNS/c1-2-7-20-12-14(11-17-16(18)6-8-21-17)9-13-4-3-5-15(19)10-13/h3-6,8,10,14,20H,2,7,9,11-12H2,1H3 |
| InChIKey | UJWXVJCAYPUCDP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|