C15H23BrFN — CID 55197357
2-[(3-bromo-4-fluorophenyl)methyl]-N-propylpentan-1-amine (PubChem CID 55197357) has the molecular formula C15H23BrFN and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-[(3-bromo-4-fluorophenyl)methyl]-N-propylpentan-1-amine.
| Compound Name | 2-[(3-bromo-4-fluorophenyl)methyl]-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 55197357 |
| Molecular Formula | C15H23BrFN |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[(3-bromo-4-fluorophenyl)methyl]-N-propylpentan-1-amine |
| SMILES | CCCNCC(CCC)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H23BrFN/c1-3-5-13(11-18-8-4-2)9-12-6-7-15(17)14(16)10-12/h6-7,10,13,18H,3-5,8-9,11H2,1-2H3 |
| InChIKey | SXUGYNPTRWDKAM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|