C18H21BrFN — CID 79436436
2-(2-bromophenyl)-3-(3-fluorophenyl)-N-propylpropan-1-amine (PubChem CID 79436436) has the molecular formula C18H21BrFN and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3-(3-fluorophenyl)-N-propylpropan-1-amine.
| Compound Name | 2-(2-bromophenyl)-3-(3-fluorophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79436436 |
| Molecular Formula | C18H21BrFN |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(2-bromophenyl)-3-(3-fluorophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1cccc(F)c1)c1ccccc1Br |
| InChI | InChI=1S/C18H21BrFN/c1-2-10-21-13-15(17-8-3-4-9-18(17)19)11-14-6-5-7-16(20)12-14/h3-9,12,15,21H,2,10-11,13H2,1H3 |
| InChIKey | AARYKTLICREMMC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|