C17H25N3 — CID 63002106
N-(1H-indol-4-ylmethyl)-2-(4-methylpiperidin-1-yl)ethanamine (PubChem CID 63002106) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-(1H-indol-4-ylmethyl)-2-(4-methylpiperidin-1-yl)ethanamine.
| Compound Name | N-(1H-indol-4-ylmethyl)-2-(4-methylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 63002106 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-(1H-indol-4-ylmethyl)-2-(4-methylpiperidin-1-yl)ethanamine |
| SMILES | CC1CCN(CCNCc2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C17H25N3/c1-14-6-10-20(11-7-14)12-9-18-13-15-3-2-4-17-16(15)5-8-19-17/h2-5,8,14,18-19H,6-7,9-13H2,1H3 |
| InChIKey | QSHUWGCIWYREGX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|