C12H18ClN3OS — CID 63004510
1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-1,4-diazepan-5-one (PubChem CID 63004510) has the molecular formula C12H18ClN3OS and a molecular weight of 287.82 g/mol. Its IUPAC name is 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-1,4-diazepan-5-one.
| Compound Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63004510 |
| Molecular Formula | C12H18ClN3OS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-1,4-diazepan-5-one |
| SMILES | CCC(c1nc(CCl)cs1)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C12H18ClN3OS/c1-2-10(12-15-9(7-13)8-18-12)16-5-3-11(17)14-4-6-16/h8,10H,2-7H2,1H3,(H,14,17) |
| InChIKey | SLENVXSPHZBZFF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|