C11H21N3O — CID 63004638
1-(piperidin-3-ylmethyl)-1,4-diazepan-5-one (PubChem CID 63004638) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(piperidin-3-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 1-(piperidin-3-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63004638 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(piperidin-3-ylmethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CC2CCCNC2)CCN1 |
| InChI | InChI=1S/C11H21N3O/c15-11-3-6-14(7-5-13-11)9-10-2-1-4-12-8-10/h10,12H,1-9H2,(H,13,15) |
| InChIKey | HAHNELOIQJAYTO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |