C15H24N4OS — CID 63007916
2-[[3-methoxypropyl(methyl)amino]methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63007916) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[[3-methoxypropyl(methyl)amino]methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[[3-methoxypropyl(methyl)amino]methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63007916 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[[3-methoxypropyl(methyl)amino]methyl]-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(CN(C)CCCOC)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C15H24N4OS/c1-10-11(2)21-15-13(10)14(16-3)17-12(18-15)9-19(4)7-6-8-20-5/h6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | OAAMQVZSFNYMHD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|