C8H19N3O2 — CID 63009708
2-amino-3-[3-methoxypropyl(methyl)amino]propanamide (PubChem CID 63009708) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-amino-3-[3-methoxypropyl(methyl)amino]propanamide.
| Compound Name | 2-amino-3-[3-methoxypropyl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 63009708 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-amino-3-[3-methoxypropyl(methyl)amino]propanamide |
| SMILES | COCCCN(C)CC(N)C(N)=O |
| InChI | InChI=1S/C8H19N3O2/c1-11(4-3-5-13-2)6-7(9)8(10)12/h7H,3-6,9H2,1-2H3,(H2,10,12) |
| InChIKey | LXWJYGRDOFCXSL-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|