About 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine
2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine (PubChem CID 63013198) has the molecular formula C16H32N4
and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine |
| PubChem CID | 63013198 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine |
| SMILES | CCCCCCCC(C)(CN)N(C)Cc1nccn1C |
| InChI | InChI=1S/C16H32N4/c1-5-6-7-8-9-10-16(2,14-17)20(4)13-15-18-11-12-19(15)3/h11-12H,5-10,13-14,17H2,1-4H3 |
| InChIKey | NXZYEHBFMLXUFR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine?
The IUPAC name of 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine (CID 63013198) is 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine.
What is the SMILES notation for 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine?
The canonical SMILES for 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine is CCCCCCCC(C)(CN)N(C)Cc1nccn1C.
What is the InChIKey of 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine?
The InChIKey is NXZYEHBFMLXUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4/c1-5-6-7-8-9-10-16(2,14-17)20(4)13-15-18-11-12-19(15)3/h11-12H,5-10,13-14,17H2,1-4H3.
What are the key properties of 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine?
2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine has a molecular weight of 280.46 g/mol, XLogP of 2.93, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-dimethyl-2-N-[(1-methylimidazol-2-yl)methyl]nonane-1,2-diamine is sourced from PubChem (CID 63013198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).