C12H10Cl2N4O — CID 63015031
(2,6-dichloro-4-pyridinyl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone (PubChem CID 63015031) has the molecular formula C12H10Cl2N4O and a molecular weight of 297.15 g/mol. Its IUPAC name is (2,6-dichloro-4-pyridinyl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone.
| Compound Name | (2,6-dichloro-4-pyridinyl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 63015031 |
| Molecular Formula | C12H10Cl2N4O |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (2,6-dichloro-4-pyridinyl)-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)methanone |
| SMILES | O=C(c1cc(Cl)nc(Cl)c1)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H10Cl2N4O/c13-9-5-8(6-10(14)16-9)12(19)18-4-3-17-2-1-15-11(17)7-18/h1-2,5-6H,3-4,7H2 |
| InChIKey | DORXWTCWNDPTOD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|