C17H19ClO2 — CID 63016287
1-[1-chloro-2-(2-methylphenyl)ethyl]-2,3-dimethoxybenzene (PubChem CID 63016287) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-[1-chloro-2-(2-methylphenyl)ethyl]-2,3-dimethoxybenzene.
| Compound Name | 1-[1-chloro-2-(2-methylphenyl)ethyl]-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 63016287 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-[1-chloro-2-(2-methylphenyl)ethyl]-2,3-dimethoxybenzene |
| SMILES | COc1cccc(C(Cl)Cc2ccccc2C)c1OC |
| InChI | InChI=1S/C17H19ClO2/c1-12-7-4-5-8-13(12)11-15(18)14-9-6-10-16(19-2)17(14)20-3/h4-10,15H,11H2,1-3H3 |
| InChIKey | KZJOQOVAMBZIII-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|