C17H19ClO — CID 63542139
1-[1-chloro-2-(2-methoxyphenyl)ethyl]-2,3-dimethylbenzene (PubChem CID 63542139) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is 1-[1-chloro-2-(2-methoxyphenyl)ethyl]-2,3-dimethylbenzene.
| Compound Name | 1-[1-chloro-2-(2-methoxyphenyl)ethyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 63542139 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-[1-chloro-2-(2-methoxyphenyl)ethyl]-2,3-dimethylbenzene |
| SMILES | COc1ccccc1CC(Cl)c1cccc(C)c1C |
| InChI | InChI=1S/C17H19ClO/c1-12-7-6-9-15(13(12)2)16(18)11-14-8-4-5-10-17(14)19-3/h4-10,16H,11H2,1-3H3 |
| InChIKey | RKGPMQHQIUVUOL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|