C17H18O4 — CID 63019197
1,3-dihydro-2-benzofuran-5-yl-(3,5-dimethoxyphenyl)methanol (PubChem CID 63019197) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl-(3,5-dimethoxyphenyl)methanol.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl-(3,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 63019197 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl-(3,5-dimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)cc(C(O)c2ccc3c(c2)COC3)c1 |
| InChI | InChI=1S/C17H18O4/c1-19-15-6-13(7-16(8-15)20-2)17(18)11-3-4-12-9-21-10-14(12)5-11/h3-8,17-18H,9-10H2,1-2H3 |
| InChIKey | VPFRGQKSHAVUJS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |