C15H14O2 — CID 63019916
1,3-dihydro-2-benzofuran-5-yl(phenyl)methanol (PubChem CID 63019916) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl(phenyl)methanol.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl(phenyl)methanol |
|---|---|
| PubChem CID | 63019916 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl(phenyl)methanol |
| SMILES | OC(c1ccccc1)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C15H14O2/c16-15(11-4-2-1-3-5-11)12-6-7-13-9-17-10-14(13)8-12/h1-8,15-16H,9-10H2 |
| InChIKey | DMIVBZVUKUPDAF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |