C15H13ClO2 — CID 63021648
(2-chlorophenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanol (PubChem CID 63021648) has the molecular formula C15H13ClO2 and a molecular weight of 260.72 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanol.
| Compound Name | (2-chlorophenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanol |
|---|---|
| PubChem CID | 63021648 |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2-chlorophenyl)-(1,3-dihydro-2-benzofuran-5-yl)methanol |
| SMILES | OC(c1ccc2c(c1)COC2)c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClO2/c16-14-4-2-1-3-13(14)15(17)10-5-6-11-8-18-9-12(11)7-10/h1-7,15,17H,8-9H2 |
| InChIKey | FOXVYCYJUZFPJH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |