C17H23ClN2S — CID 63020323
2-[(2-chlorophenyl)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-N-propylpropan-1-amine (PubChem CID 63020323) has the molecular formula C17H23ClN2S and a molecular weight of 322.91 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-N-propylpropan-1-amine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 63020323 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.91 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1cnc(C)s1)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN2S/c1-3-8-19-11-14(10-16-12-20-13(2)21-16)9-15-6-4-5-7-17(15)18/h4-7,12,14,19H,3,8-11H2,1-2H3 |
| InChIKey | ZKDISPUOGMBOIC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|