C14H15BrClNS — CID 66043151
5-[2-(bromomethyl)-3-(2-chlorophenyl)propyl]-2-methyl-1,3-thiazole (PubChem CID 66043151) has the molecular formula C14H15BrClNS and a molecular weight of 344.71 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3-(2-chlorophenyl)propyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[2-(bromomethyl)-3-(2-chlorophenyl)propyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 66043151 |
| Molecular Formula | C14H15BrClNS |
| Molecular Weight | 344.71 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 5-[2-(bromomethyl)-3-(2-chlorophenyl)propyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(CC(CBr)Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C14H15BrClNS/c1-10-17-9-13(18-10)7-11(8-15)6-12-4-2-3-5-14(12)16/h2-5,9,11H,6-8H2,1H3 |
| InChIKey | ZBWKFLMFVWDYNH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|