About 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine
1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine (PubChem CID 63023322) has the molecular formula C16H30N2O2S
and a molecular weight of 314.50 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine |
| PubChem CID | 63023322 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine |
| SMILES | CC1(C)C2CCC1(C)C(NC1CCN(S(C)(=O)=O)CC1)C2 |
| InChI | InChI=1S/C16H30N2O2S/c1-15(2)12-5-8-16(15,3)14(11-12)17-13-6-9-18(10-7-13)21(4,19)20/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | WVXDGMWMLBDHMV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine?
The IUPAC name of 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine (CID 63023322) is 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine.
What is the SMILES notation for 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine?
The canonical SMILES for 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine is CC1(C)C2CCC1(C)C(NC1CCN(S(C)(=O)=O)CC1)C2.
What is the InChIKey of 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine?
The InChIKey is WVXDGMWMLBDHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2S/c1-15(2)12-5-8-16(15,3)14(11-12)17-13-6-9-18(10-7-13)21(4,19)20/h12-14,17H,5-11H2,1-4H3.
What are the key properties of 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine?
1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine has a molecular weight of 314.50 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)piperidin-4-amine is sourced from PubChem (CID 63023322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).