C15H19N3O3 — CID 63024009
5-[[2-cyanoethyl(ethyl)carbamoyl]amino]-2,3-dimethylbenzoic acid (PubChem CID 63024009) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[[2-cyanoethyl(ethyl)carbamoyl]amino]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[[2-cyanoethyl(ethyl)carbamoyl]amino]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63024009 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-[[2-cyanoethyl(ethyl)carbamoyl]amino]-2,3-dimethylbenzoic acid |
| SMILES | CCN(CCC#N)C(=O)Nc1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-4-18(7-5-6-16)15(21)17-12-8-10(2)11(3)13(9-12)14(19)20/h8-9H,4-5,7H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | NUEILXUOHMRRAA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |