C15H22ClN5 — CID 63024811
5-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridin-2-amine (PubChem CID 63024811) has the molecular formula C15H22ClN5 and a molecular weight of 307.83 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63024811 |
| Molecular Formula | C15H22ClN5 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1nc(N(C)Cc2nccn2C)ccc1Cl |
| InChI | InChI=1S/C15H22ClN5/c1-4-7-17-10-13-12(16)5-6-14(19-13)21(3)11-15-18-8-9-20(15)2/h5-6,8-9,17H,4,7,10-11H2,1-3H3 |
| InChIKey | XZFJCJUQMYBYGG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|