C14H22N6 — CID 63025157
N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridazin-3-amine (PubChem CID 63025157) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridazin-3-amine.
| Compound Name | N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 63025157 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-methyl-N-[(1-methylimidazol-2-yl)methyl]-6-(propylaminomethyl)pyridazin-3-amine |
| SMILES | CCCNCc1ccc(N(C)Cc2nccn2C)nn1 |
| InChI | InChI=1S/C14H22N6/c1-4-7-15-10-12-5-6-13(18-17-12)20(3)11-14-16-8-9-19(14)2/h5-6,8-9,15H,4,7,10-11H2,1-3H3 |
| InChIKey | HUJSBHWJZWRVEG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|