C14H20N6 — CID 63025331
6-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylimidazol-2-yl)methyl]pyridazin-3-amine (PubChem CID 63025331) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 6-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylimidazol-2-yl)methyl]pyridazin-3-amine.
| Compound Name | 6-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylimidazol-2-yl)methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 63025331 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6-[(cyclopropylamino)methyl]-N-methyl-N-[(1-methylimidazol-2-yl)methyl]pyridazin-3-amine |
| SMILES | CN(Cc1nccn1C)c1ccc(CNC2CC2)nn1 |
| InChI | InChI=1S/C14H20N6/c1-19-8-7-15-14(19)10-20(2)13-6-5-12(17-18-13)9-16-11-3-4-11/h5-8,11,16H,3-4,9-10H2,1-2H3 |
| InChIKey | JJXDEIWNOJMLPR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |