C13H16N6O2 — CID 63025123
[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-2-nitrophenyl]hydrazine (PubChem CID 63025123) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-2-nitrophenyl]hydrazine.
| Compound Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 63025123 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-2-nitrophenyl]hydrazine |
| SMILES | NNc1ccc(CN2CCn3ccnc3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O2/c14-16-11-2-1-10(7-12(11)19(20)21)8-17-5-6-18-4-3-15-13(18)9-17/h1-4,7,16H,5-6,8-9,14H2 |
| InChIKey | NSYYFEHKEJOUPL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|