About 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol
2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol (PubChem CID 63025148) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol |
| PubChem CID | 63025148 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol |
| SMILES | OC1CCCC1CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H19N3O/c16-11-3-1-2-10(11)8-14-6-7-15-5-4-13-12(15)9-14/h4-5,10-11,16H,1-3,6-9H2 |
| InChIKey | VIIYZZZKZZCNFX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol?
The IUPAC name of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol (CID 63025148) is 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol.
What is the SMILES notation for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol?
The canonical SMILES for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol is OC1CCCC1CN1CCn2ccnc2C1.
What is the InChIKey of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol?
The InChIKey is VIIYZZZKZZCNFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c16-11-3-1-2-10(11)8-14-6-7-15-5-4-13-12(15)9-14/h4-5,10-11,16H,1-3,6-9H2.
What are the key properties of 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol?
2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol has a molecular weight of 221.30 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)cyclopentan-1-ol is sourced from PubChem (CID 63025148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).