C15H25N5 — CID 63026298
6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile (PubChem CID 63026298) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile.
| Compound Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 63026298 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 6-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile |
| SMILES | CCNC(C)(C#N)CCCCN1CCn2ccnc2C1 |
| InChI | InChI=1S/C15H25N5/c1-3-18-15(2,13-16)6-4-5-8-19-10-11-20-9-7-17-14(20)12-19/h7,9,18H,3-6,8,10-12H2,1-2H3 |
| InChIKey | VBMQFUMNUYJZFW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|