C14H24N6 — CID 64578836
6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile (PubChem CID 64578836) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile.
| Compound Name | 6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile |
|---|---|
| PubChem CID | 64578836 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(ethylamino)-2-methylhexanenitrile |
| SMILES | CCNC(C)(C#N)CCCCN1CCn2cnnc2C1 |
| InChI | InChI=1S/C14H24N6/c1-3-16-14(2,11-15)6-4-5-7-19-8-9-20-12-17-18-13(20)10-19/h12,16H,3-10H2,1-2H3 |
| InChIKey | KHNLOVNXZKXADM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|