C11H17N3O3 — CID 63032762
1-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 63032762) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63032762 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CN(CCC#N)C(=O)CN1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H17N3O3/c1-13(5-2-4-12)10(15)8-14-6-3-9(7-14)11(16)17/h9H,2-3,5-8H2,1H3,(H,16,17) |
| InChIKey | PYGVOVJKJDRABU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |