C11H19N5O2S — CID 63033610
4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(propan-2-ylamino)butanoic acid (PubChem CID 63033610) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(propan-2-ylamino)butanoic acid.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 63033610 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(propan-2-ylamino)butanoic acid |
| SMILES | CC(C)NC(CCSc1nnnn1C1CC1)C(=O)O |
| InChI | InChI=1S/C11H19N5O2S/c1-7(2)12-9(10(17)18)5-6-19-11-13-14-15-16(11)8-3-4-8/h7-9,12H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | DWRJQHXSYJNRJX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |