C14H9F4N3 — CID 63037715
2-[2-fluoro-5-(trifluoromethyl)anilino]-6-methylpyridine-3-carbonitrile (PubChem CID 63037715) has the molecular formula C14H9F4N3 and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-[2-fluoro-5-(trifluoromethyl)anilino]-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[2-fluoro-5-(trifluoromethyl)anilino]-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 63037715 |
| Molecular Formula | C14H9F4N3 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[2-fluoro-5-(trifluoromethyl)anilino]-6-methylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(Nc2cc(C(F)(F)F)ccc2F)n1 |
| InChI | InChI=1S/C14H9F4N3/c1-8-2-3-9(7-19)13(20-8)21-12-6-10(14(16,17)18)4-5-11(12)15/h2-6H,1H3,(H,20,21) |
| InChIKey | RGKBWPLJLATKNG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |