C12H8F2N4 — CID 112755031
4-(2,5-difluoroanilino)-2-methylpyrimidine-5-carbonitrile (PubChem CID 112755031) has the molecular formula C12H8F2N4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 4-(2,5-difluoroanilino)-2-methylpyrimidine-5-carbonitrile.
| Compound Name | 4-(2,5-difluoroanilino)-2-methylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 112755031 |
| Molecular Formula | C12H8F2N4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-(2,5-difluoroanilino)-2-methylpyrimidine-5-carbonitrile |
| SMILES | Cc1ncc(C#N)c(Nc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C12H8F2N4/c1-7-16-6-8(5-15)12(17-7)18-11-4-9(13)2-3-10(11)14/h2-4,6H,1H3,(H,16,17,18) |
| InChIKey | WBEFJQIHZSLHEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |