C11H11F2N5 — CID 80920264
N-(2,5-difluorophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine (PubChem CID 80920264) has the molecular formula C11H11F2N5 and a molecular weight of 251.24 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80920264 |
| Molecular Formula | C11H11F2N5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-hydrazinyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(NN)ncnc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F2N5/c1-6-10(15-5-16-11(6)18-14)17-9-4-7(12)2-3-8(9)13/h2-5H,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | ISNQGSPGZYLUQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|