C15H21ClFN — CID 63038280
N-[2-(2-chloro-4-fluorophenyl)-2-ethylbutyl]cyclopropanamine (PubChem CID 63038280) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is N-[2-(2-chloro-4-fluorophenyl)-2-ethylbutyl]cyclopropanamine.
| Compound Name | N-[2-(2-chloro-4-fluorophenyl)-2-ethylbutyl]cyclopropanamine |
|---|---|
| PubChem CID | 63038280 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[2-(2-chloro-4-fluorophenyl)-2-ethylbutyl]cyclopropanamine |
| SMILES | CCC(CC)(CNC1CC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H21ClFN/c1-3-15(4-2,10-18-12-6-7-12)13-8-5-11(17)9-14(13)16/h5,8-9,12,18H,3-4,6-7,10H2,1-2H3 |
| InChIKey | XKECMHFLYLOERA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |