C17H24ClFN2O2 — CID 111122934
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 111122934) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 111122934 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | CC(C)(CNC(=O)NC1CCC(O)CC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H24ClFN2O2/c1-17(2,14-8-3-11(19)9-15(14)18)10-20-16(23)21-12-4-6-13(22)7-5-12/h3,8-9,12-13,22H,4-7,10H2,1-2H3,(H2,20,21,23) |
| InChIKey | MMQXPUHFSFPETJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |