C10H19N3O5S — CID 63043362
3-(2-sulfamoylethylcarbamoylamino)cyclohexane-1-carboxylic acid (PubChem CID 63043362) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(2-sulfamoylethylcarbamoylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(2-sulfamoylethylcarbamoylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63043362 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-(2-sulfamoylethylcarbamoylamino)cyclohexane-1-carboxylic acid |
| SMILES | NS(=O)(=O)CCNC(=O)NC1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C10H19N3O5S/c11-19(17,18)5-4-12-10(16)13-8-3-1-2-7(6-8)9(14)15/h7-8H,1-6H2,(H,14,15)(H2,11,17,18)(H2,12,13,16) |
| InChIKey | LTTATWWNCZJDIW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |