C14H11Cl3N2O — CID 63045441
N-(2-amino-4-chlorophenyl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 63045441) has the molecular formula C14H11Cl3N2O and a molecular weight of 329.61 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 63045441 |
| Molecular Formula | C14H11Cl3N2O |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | Nc1cc(Cl)ccc1NC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3N2O/c15-9-2-4-13(12(18)7-9)19-14(20)6-8-1-3-10(16)11(17)5-8/h1-5,7H,6,18H2,(H,19,20) |
| InChIKey | MANVAZLQSMMTNL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|