C14H10Br2Cl2N2O — CID 63046307
N-(2-amino-4,6-dibromophenyl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 63046307) has the molecular formula C14H10Br2Cl2N2O and a molecular weight of 452.96 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 63046307 |
| Molecular Formula | C14H10Br2Cl2N2O |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 449.85 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | Nc1cc(Br)cc(Br)c1NC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Br2Cl2N2O/c15-8-5-9(16)14(12(19)6-8)20-13(21)4-7-1-2-10(17)11(18)3-7/h1-3,5-6H,4,19H2,(H,20,21) |
| InChIKey | QCESEYBWYHTTMC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|