C15H27N3 — CID 63049206
N,5-ditert-butyl-4,5,6,7-tetrahydro-1H-indazol-3-amine (PubChem CID 63049206) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N,5-ditert-butyl-4,5,6,7-tetrahydro-1H-indazol-3-amine.
| Compound Name | N,5-ditert-butyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 63049206 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N,5-ditert-butyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
| SMILES | CC(C)(C)Nc1n[nH]c2c1CC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C15H27N3/c1-14(2,3)10-7-8-12-11(9-10)13(18-17-12)16-15(4,5)6/h10H,7-9H2,1-6H3,(H2,16,17,18) |
| InChIKey | VZXKVJNOKJONEO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |