C12H20N2 — CID 165463449
5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indazole (PubChem CID 165463449) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indazole.
| Compound Name | 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indazole |
|---|---|
| PubChem CID | 165463449 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-2H-indazole |
| SMILES | Cc1[nH]nc2c1CC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C12H20N2/c1-8-10-7-9(12(2,3)4)5-6-11(10)14-13-8/h9H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | YALPGGLIIOWPST-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |