About 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran
5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 158199396) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran.
Analyze 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The IUPAC name of 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran (CID 158199396) is 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran.
What is the SMILES notation for 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The canonical SMILES for 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran is Cc1coc2c1CC(C(C)(C)C)CC2.
What is the InChIKey of 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The InChIKey is SEMIYLYWVAJXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-9-8-14-12-6-5-10(7-11(9)12)13(2,3)4/h8,10H,5-7H2,1-4H3.
What are the key properties of 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran?
5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran has a molecular weight of 192.30 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-methyl-4,5,6,7-tetrahydro-1-benzofuran is sourced from PubChem (CID 158199396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).