C15H18O — CID 10608682
(5aS,8aS)-1-methyl-5,8-dimethylidene-4,5a,6,7,8a,9-hexahydroazuleno[6,5-b]furan (PubChem CID 10608682) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (5aS,8aS)-1-methyl-5,8-dimethylidene-4,5a,6,7,8a,9-hexahydroazuleno[6,5-b]furan.
| Compound Name | (5aS,8aS)-1-methyl-5,8-dimethylidene-4,5a,6,7,8a,9-hexahydroazuleno[6,5-b]furan |
|---|---|
| PubChem CID | 10608682 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (5aS,8aS)-1-methyl-5,8-dimethylidene-4,5a,6,7,8a,9-hexahydroazuleno[6,5-b]furan |
| SMILES | C=C1Cc2occ(C)c2C[C@@H]2C(=C)CC[C@H]12 |
| InChI | InChI=1S/C15H18O/c1-9-4-5-12-10(2)6-15-14(7-13(9)12)11(3)8-16-15/h8,12-13H,1-2,4-7H2,3H3/t12-,13-/m1/s1 |
| InChIKey | IYXVWVHLIFWPEX-CHWSQXEVSA-N |
| XLogP | 3.83 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|