C14H16N4 — CID 63049531
4-[3-(2-methylpropylamino)-1H-pyrazol-5-yl]benzonitrile (PubChem CID 63049531) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-[3-(2-methylpropylamino)-1H-pyrazol-5-yl]benzonitrile.
| Compound Name | 4-[3-(2-methylpropylamino)-1H-pyrazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 63049531 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-[3-(2-methylpropylamino)-1H-pyrazol-5-yl]benzonitrile |
| SMILES | CC(C)CNc1cc(-c2ccc(C#N)cc2)[nH]n1 |
| InChI | InChI=1S/C14H16N4/c1-10(2)9-16-14-7-13(17-18-14)12-5-3-11(8-15)4-6-12/h3-7,10H,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | DZLDWAWOHGDFBX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |