C11H13FN2OS — CID 63049825
N-(2-amino-2-sulfanylideneethyl)-5-fluoro-N,2-dimethylbenzamide (PubChem CID 63049825) has the molecular formula C11H13FN2OS and a molecular weight of 240.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-5-fluoro-N,2-dimethylbenzamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-5-fluoro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 63049825 |
| Molecular Formula | C11H13FN2OS |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-5-fluoro-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)N(C)CC(N)=S |
| InChI | InChI=1S/C11H13FN2OS/c1-7-3-4-8(12)5-9(7)11(15)14(2)6-10(13)16/h3-5H,6H2,1-2H3,(H2,13,16) |
| InChIKey | XVMMNKMFNYQILN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|