C17H14N4O4S2 — CID 6305122
(E)-N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 6305122) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (E)-N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6305122 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (E)-N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | CC(=O)N1CCc2c(sc(NC(=O)/C=C/c3ccc([N+](=O)[O-])s3)c2C#N)C1 |
| InChI | InChI=1S/C17H14N4O4S2/c1-10(22)20-7-6-12-13(8-18)17(27-14(12)9-20)19-15(23)4-2-11-3-5-16(26-11)21(24)25/h2-5H,6-7,9H2,1H3,(H,19,23)/b4-2+ |
| InChIKey | NFPAMEDYBHJLMM-DUXPYHPUSA-N |
| XLogP | 3.15 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|