C15H11N3O3S2 — CID 4071853
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 4071853) has the molecular formula C15H11N3O3S2 and a molecular weight of 345.41 g/mol. Its IUPAC name is N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4071853 |
| Molecular Formula | C15H11N3O3S2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | N#Cc1c(NC(=O)C=Cc2ccc([N+](=O)[O-])s2)sc2c1CCC2 |
| InChI | InChI=1S/C15H11N3O3S2/c16-8-11-10-2-1-3-12(10)23-15(11)17-13(19)6-4-9-5-7-14(22-9)18(20)21/h4-7H,1-3H2,(H,17,19) |
| InChIKey | CVBWZEUAYPFPQD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|